افتح القائمة الرئيسية

گلايسين

(تم التحويل من Glycine)

الگلايسين Glycine (اختصاره Gly أو G)[4]، هو مركب عضوي صيغته الكيميائية NH2CH2COOH. بامتلاكه مستبدل هيدروجين كما في سلسلته الجانبية، يعتبر الگلايسين الأصغر بين الأحماض الأمينية العشرين الشائعة في الپروتينات، وفي الواقع هو الأصغر المرجح. كودونات شفرته الوراثية هي GGU, GGC, GGA, GGG.

گلايسين[1]
Glycine-zwitterion-2D-skeletal.png
Glycin - Glycine.svg
Zwitterion of glycine
Glycine-3D-balls.png
الأسماء
اسم أيوپاك
الگلاي
أسماء أخرى
Aminoethanoic acid
Aminoacetic acid
تمييز
اختصارات Gly, G
رقم CAS [56-40-6]
PubChem 750
بنك الأدوية DB00145
KEGG D00011
ChEBI 15428
كود ATC B05CX03
SMILES
InChI InChI=1/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)
الخصائص
الصيغة الجزيئية C2H5NO2
كتلة مولية 75.06 g mol-1
المظهر صلب أبيض
الكثافة 1.607 g/cm3
نقطة الانصهار
قابلية الذوبان في الماء 24.99 گ/100 مل (25 °س)[2]
قابلية الذوبان قابل للذوبان في الپيريدين
قابل للذبان بشكل معتدل في الإيثانول
غير قابل للذوبان في إثيال
الحموضة (pKa) 2.34 (carboxyl), 9.6 (amino)[3]
المخاطر
الجرعة أو التركيز القاتل (LD, LC):
2600 mg/kg (mouse, oral)
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
YesY verify (what is YesYX mark.svgN ?)
مراجع الجدول

الگلايسين هو مادة صلبة بلورية عديمة اللون، حلوة المذاق. يعتبر فريداً بين الأحماض الأمينية المركبة للپروتينات حيث يعتبر كيرالياً. يمكنه أن يتلائم مع البيئات المحبة للماء أو الكارهة للماء، بسبب سلسلته الجانبية الدنيا التي تحتوي على ذرة هيدروجين واحدة.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

فهرست

الإنتاج

خصائص وتركيبات القاعدة الحمضية

 


الأيض

الوظائف الفسيولوجية

كوسيط تخليق حيوي

كناقل عصبي

الاستخدامات

الأغذية الحيوانية والبشرية

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

مستحضرات الجميل وتطبيقات متنوعة

المواد الخام الكيميائية

البحث والتنمية

الخصائص المضادة للشيخوخة

التواجد في الفضاء

انظر أيضاً

المصادر

  1. ^ قالب:Merck11th.
  2. ^ "Solubilities and densities". Prowl.rockefeller.edu. Retrieved 2013-11-13.
  3. ^ Dawson, R.M.C., et al., Data for Biochemical Research, Oxford, Clarendon Press, 1959.
  4. ^ قالب:IUPAC-IUB amino acids 1983.


. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

قراءات إضافية

On attempts to detect glycine in interstellar medium

وصلات خارجية