افتح القائمة الرئيسية

حمض الگلوتاميك

(تم التحويل من Glutamic acid)

حمض الگلوتاميك Glutamic acid (واختصاره Glu or E) هو مادة كيميائية تتركب من 20 حمض أميني بروتيني, وروامزه هي GAA وGAG. وهو حمض نووي غير أساسي. وتعرف الرابطة الكربوكسيلية وأملاح حمض الگلوتاميك باسم الگلوتاميدات.

حمض الگلوتاميك
Glutamic acid
Glutaminsäure - Glutamic acid.svg
تركيب حمض الگلوتاميك-ل
الأسماء
اسم أيوپاك
حمض الگلوتاميك
أسماء أخرى
2-Aminopentanedioic acid
2-Aminoglutaric acid
تمييز
رقم CAS [617-65-2],
56-86-0 (L-isomer)
6893-26-1 (D-isomer)
PubChem 611
EC-number 210-522-2
SMILES
InChI InChI=1/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)
الخصائص
الصيغة الجزيئية C5H9NO4
كتلة مولية 147.11 g mol-1
المظهر مسحوق بلوري أبيض
الكثافة 1.4601 (20 °C)
نقطة الانصهار
قابلية الذوبان في الماء قابل للذوبان
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
YesY verify (what is YesYX mark.svgN ?)
مراجع الجدول

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

فهرست

الكيماء

التاريخ

التخليق البيولوجي

الوظائف والاستخدامات

الأيض

R1-amino acid + R2-α-ketoacid R1-α-ketoacid + R2-amino acid


Alanine + α-ketoglutarate pyruvate + glutamate
Aspartate + α-ketoglutarate oxaloacetate + glutamate

Both pyruvate and oxaloacetate are key components of cellular metabolism, contributing as substrates or intermediates in fundamental processes such as glycolysis, gluconeogenesis, and the citric acid cycle.

Glutamate also plays an important role in the body's disposal of excess or waste nitrogen. Glutamate undergoes deamination, an oxidative reaction catalysed by glutamate dehydrogenase, as follows:

glutamate + water + NADP+ → α-ketoglutarate + NADPH + ammonia + H+


ناقل عصبي

 
حمض الگلوتاميك-ل في الظروف الفيسيولوجية


. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

Brain nonsynaptic glutamatergic signaling circuits

GABA precursor

محسنات الطعم


المغذيات

نمو النبات

الانتاج

علم الصيدلة

انظر أيضا


. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

المصادر

قراءات إضافية

  • Nelson, David L.; Cox, Michael M. (2005), Principles of Biochemistry (4th ed.), New York: W. H. Freeman, ISBN 0-7167-4339-6