افتح القائمة الرئيسية

فنايل‌ألانين

(تم التحويل من Phenylalanine)

فنايل‌ألانين Phenylalanine (واختصاره Phe أو F)[2] هو حمض أمينيصيغته الكيميائية C6H5CH2CH(NH2)COOH. وهذا الحمض الأميني الأساسي يُصنف على أنه غير قطبي بسبب الطبيعة الكارهة للماء لسلسلة بنزيل الجانبية. ل-فنايل‌ألانين (LPA)هو حمض أميني متعادل كهربائياً، وهو واحد من العشرين حمض أميني شائع يجري استخدامهم بيوكيماوياً لتشكيل بروتينات، مبرمجة بالدنا.

فنايل‌ألانين
الصيغة الهيكلية
Ball-and-stick model
الأسماء
اسم أيوپاك
Phenylalanine
أسماء أخرى
2-Amino-3-phenylpropanoic acid
تمييز
رقم CAS [150-30-1]
PubChem 994
بنك الأدوية DB00120
KEGG D00021
SMILES
InChI InChI=1/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1
الخصائص
الصيغة الجزيئية C9H11NO2
كتلة مولية 165.18 g mol-1
الحموضة (pKa) 1.83 (carboxyl), 9.13 (amino)[1]
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
YesY verify (what is YesYX mark.svgN ?)
مراجع الجدول

موجود في البروتين وهو ضروري لنمو الأطفال ولأيض البروتين في الأطفال والبالغين؛ متوفر في الحليب والبيض؛ و هو يتحول عادة إلى تايروسين في جسمِ الإنسانِ.

عند حدوث خلل وراثي في عملية الأيض ينتج بسبب نقص في الإنزيم المسؤول عن تحويل الفينيل ألانين إلى تايروسين، يؤدي إلى تراكمِ الفينيل ألانين في سوائل الجسم وبالتالي إلى التسبّب في مرض الفينيل كيتون يوريا.  

كودونات ل-فنايل‌ألانين هي UUU و UUC. فنايل‌ألانين هو سابق لكل من تايروسين وجزيئات الإشارة أحادية الأمين التي منها دوپامين ونورإپي‌نفرين (نورأدرنالين) وإپي‌نفرين (أدرنالين) وصبغة البشرة ملانين.

يتواجد الفنايل‌ألانين طبيعياً في لبن الثدييات. ويستخدم في تصنيع المنتجات الغذائية والشروبات ويباع كمضاف غذائي لتأثيره الشهير كمزيل للصداع ومضاد للاكتئاب. وهو سابق مباشر للمنظم العصبي فنايل‌إثيلامين، مضاف الحمية الشائع.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

فهرست

أدوار حيوية أخرى

 


في النباتات

فينايلكيتونوريا

د- ودي إل

التصنيع التجاري

 
لتعويض الدوبامين والأدرنالين المستهلكين في ضغوط الحياة.

التاريخ

انظر أيضا

المصادر

  1. ^ Dawson, R.M.C., et al., Data for Biochemical Research, Oxford, Clarendon Press, 1959.
  2. ^ IUPAC-IUBMB Joint Commission on Biochemical Nomenclature. "Nomenclature and Symbolism for Amino Acids and Peptides". Recommendations on Organic & Biochemical Nomenclature, Symbols & Terminology etc. Retrieved 2007-05-17.


. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

وصلات خارجية