إيمينتاب

إيمينتاب
البيانات السريرية
الأسماء التجارية	گليڤيك، گليڤك، وغيرها
أسماء أخرى	STI-571
AHFS/Drugs.com	Monograph
MedlinePlus	a606018
License data	EU EMA: by INN; US FDA: IMATINIB;
فئة السلامة; أثناء الحمل	AU: D ; ;
مسارات; الدواء	عن طريق الفم
فئة الدواء	عامل مضاد للأورام
رمز ATC	L01XE01 (WHO) ;
الحالة القانونية
الحالة القانونية	AU: S4 (Prescription only) ; CA: ℞-only ; UK: POM (Prescription only) ; US: ℞-only ;
بيانات الحركية الدوائية
التوافر الحيوي	98%
ارتباط الپروتين	95%
الأيض	الكبد (mainly CYP3A4-mediated)
Elimination half-life	18 س (imatinib); 40 س (active metabolite)
الإخراج	البراز (68%) والبول (13%)
المعرفات
	IUPAC name 4-[(4-methylpiperazin-1-yl)methyl]-N-(4-methyl-3-{[4-(pyridin-3-yl)pyrimidin-2-yl]amino}phenyl)benzamide;
رقم CAS	152459-95-5 ; 220127-57-1 (mesilate);
PubChem CID	5291;
IUPHAR/BPS	5687;
DrugBank	DB00619 ;
ChemSpider	5101 ;
UNII	BKJ8M8G5HI;
KEGG	D08066 ;
ChEBI	CHEBI:45783 ;
ChEMBL	CHEMBL941 ;
PDB ligand	STI (PDBe, RCSB PDB);
CompTox Dashboard (EPA)	DTXSID3037125 ;
ECHA InfoCard	100.122.739
Chemical and physical data
التركيب	C29H31N7O
الكتلة المولية	493.603 g/mol; 589.7 g/mol (mesilate)
3D model (JSmol)	Interactive image;
	SMILES Cc1ccc(cc1Nc2nccc(n2)c3cccnc3)NC(=O)c4ccc(cc4)CN5CCN(CC5)C;
	InChI InChI=1S/C29H31N7O/c1-21-5-10-25(18-27(21)34-29-31-13-11-26(33-29)24-4-3-12-30-19-24)32-28(37)23-8-6-22(7-9-23)20-36-16-14-35(2)15-17-36/h3-13,18-19H,14-17,20H2,1-2H3,(H,32,37)(H,31,33,34) ; Key:KTUFNOKKBVMGRW-UHFFFAOYSA-N ;
	(verify)

إيمينتاب Imatinib (INN)، تسوقه نوڤارتس باسم گليڤك Gleevec (في الولايات المتحدة) أو Glivec (أوروپا/أستراليا/أمريكا اللاتينية)، is a competitive tyrosine-kinase inhibitor used in the treatment of multiple cancers, most notably Philadelphia chromosome-positive (Ph⁺) chronic myelogenous leukemia (CML).^[2] Like all tyrosine-kinase inhibitors, imatinib works by preventing a central tyrosine kinase enzyme, in this case BCR-Abl, from phosphorylating subsequent proteins and initiating the signaling cascade necessary for cancer development, thus preventing the growth of cancer cells and leading to their death by apoptosis.^[3] Because the BCR-Abl tyrosine kinase enzyme exists only in cancer cells and not in healthy cells, imatinib works as a form of targeted therapy—only cancer cells are killed through the drug's action.^[4] In this regard, imatinib was one of the first cancer therapies to show the potential for such targeted action, and is often cited as a paradigm for research in cancer therapeutics.^[5]

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

التاريخ

الاستخدامات

السريرية

ابيضاض الدم النقوي المزمن

الأورام السدوية المعدية المعوية

استخدامات أخرى

الأورام الليفية العصبية الضفيرية

الاستخدام التجريبي

الآثار الضارة

bcr-abl kinase (green), which causes CML, inhibited by imatinib (red; small molecule).

علم الأدوية

الحرائك الدوائية

آلية الدواء

التفاعلات الدوائية

التكاليف

عبوة من أقراص گليڤك 400-مل، تباع في ألمانيا.

دعاوى قضائية

في 1 أبريل 2013 رفضت المحكمة العليا الهندية دعوى شركة نوڤارتس السويسرية للأدوية، للاحتفاظ ببراءة اختراع عقار گليڤك الجديد لعلاج مرض إبيضاض الدم، على أساس أن النوع الجديد من الدواء لا يختلف كثيراً عن المنتج القديم. ^[6]

قرار المحكمة يبدو هدية للمرضى الساعين إلى الحصول على أدوية أرخص مصنعة بمعرفة شركات هندية، لكنه سيؤثر في عديد الشركات الأخرى ونوعية أدويتها. وفي المقابل فإن دواء الشركة السويسرية الجديد حصل على براءة الاختراع في نحو أربعين دولة، من بينها الولايات المتحدة والصين.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

انظر أيضاً

المصادر

^ خطأ استشهاد: وسم <ref> غير صحيح؛ لا نص تم توفيره للمراجع المسماة AHFS2017
^ Novartis Pharma AG. Gleevec® (imatinib mesylate) tablets prescribing information. East Hanover, NJ; 2006 Sep. Anon. Drugs of choice for cancer. Treat Guidel Med Lett. 2003; 1:41-52
^ Goldman, J.M. & Melo, J.V. Chronic myeloid leukemia—advances in biology and new approaches to treatment. N Engl J Med 349, 1451-1464 (2003)
^ Fausel, C. Targeted chronic myeloid leukemia therapy: Seeking a cure. Am J Health Syst Pharm 64, S9-15 (2007)
^ Stegmeier, F., et al. (2010). "Targeted Cancer Therapies in the Twenty-First Century: Lessons From Imatinib." Clin Pharmacol Ther 87(5): 543-552.
^ "القضاء الهندي يرفض براءة اختراع لشركة أدوية سويسرية". وكالة الأنباء الأوروپية. 2013-04-01. Retrieved 2013-04-02.

وصلات خارجية

الكلمات الدالة:

[AHFS2017-1] خطأ استشهاد: وسم <ref> غير صحيح؛ لا نص تم توفيره للمراجع المسماة AHFS2017

[2] Novartis Pharma AG. Gleevec® (imatinib mesylate) tablets prescribing information. East Hanover, NJ; 2006 Sep. Anon. Drugs of choice for cancer. Treat Guidel Med Lett. 2003; 1:41-52

[3] Goldman, J.M. & Melo, J.V. Chronic myeloid leukemia—advances in biology and new approaches to treatment. N Engl J Med 349, 1451-1464 (2003)

[4] Fausel, C. Targeted chronic myeloid leukemia therapy: Seeking a cure. Am J Health Syst Pharm 64, S9-15 (2007)

[5] Stegmeier, F., et al. (2010). "Targeted Cancer Therapies in the Twenty-First Century: Lessons From Imatinib." Clin Pharmacol Ther 87(5): 543-552.

[6] "القضاء الهندي يرفض براءة اختراع لشركة أدوية سويسرية". وكالة الأنباء الأوروپية. 2013-04-01. Retrieved 2013-04-02.

[2]

[3]

[4]

[5]

[1]

[6]