افتح القائمة الرئيسية

فيتامين ب7

(تم التحويل من فيتامين بي7 (بيوتين))

بيوتين هو فيتامين بي7. والبيوتين عبارة عن أحد مشتقات الاميدازول وهو متوفر في جميع الأطعمة الطبيعية تقريباً.

Skeletal formula of biotin
Ball-and-stick model of the Biotin molecule
اسم أيوپاك
5-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid
أسماء أخرى
Vitamin B7; Vitamin H; Coenzyme R; Biopeiderm
رقم CAS [58-85-5]
PubChem 171548
بنك الأدوية DB00121
KEGG D00029
ChEBI 15956
InChI InChI=1/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1
الصيغة الجزيئية C10H16N2O3S
كتلة مولية 244.29 g mol-1
المظهر White crystalline needles
نقطة الانصهار
قابلية الذوبان في الماء 22 mg/100 mL
NFPA 704 (معيـَّن النار)
Flammability code 1: لابد أن يكون ساخناً مسبقاً قبل أن يحدث اشتعال. نقطة الوميض فوق 93 °س (200 °ف). مثل زيت الكانولاHealth code 1: التعرض سيتسبب في تهيجاً ولكن لا يترك سوى جروح طفيفة باقية. مثل زيت الترپنتينReactivity code 0: مستقر في العادة، حتى تحت ظروف التعرض للنار، ولا يتفاعل مع الماء. مثل النيتروجين السائلSpecial hazards (white): no codeNFPA 704 four-colored diamond
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
YesY verify (what is YesYX mark.svgN ?)
مراجع الجدول

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .


أهميته الحيوية

هذا الفيتامين مهم لأنه يعمل كمساعد إنزيم لإنزيمات الكربوكسيليز الأربعة المعتمدة على البيوتين وهي:

  1. بيروفات كربوكسيليز Pyruvate carboxylase الذي يعمل على التفاعل الأول في تكوين الجلوكوز من الجزيئات العضوية الأخرى gluconeogenesis ويجدد حمض الأوكسالوأسيتيك لدورة حمض الستريك.
  2. أسيتيل كو-أ كربوكسيليز Acetyl-CoA carboxylase الذي يكون الأحماض الدهنية.
  3. بروبيونيل كو-أ كربوكسيليز Propionyl-CoA carboxylase الذي يشارك في دورة حمض الستريك.
  4. بيتا ميثيل كو-أ كربوكسيليز Beta-methyl-CoA carboxylase الذي يهدم الحمض الأميني ليوسين وبعض المركبات الأيزوبرينويدية.

التخليق الحيوي

دين برك، عالم الكيمياء الحيوية، يعمل على عزل البيوتين.

الآثار الجانبية

نقص البيوتين يكون غالباً نتيجة عيوب في استخدامه وليس لنقصه في الغذاء لأنه يصنع بواسطة البكتيريا المعوية. ونقص البيوتين نادر لأن كمية كبيرة منه يعاد استخدامها عدة مرات قبل إخراجها في البول أو البراز.

أسباب نقص البيوتين

1. تناول بياض البيض النئ الذي يحتوي على بروتين افيدين avidin الذي يرتبط بقوة بالفيتامين بي7 مانعاً امتصاصه وهذا الارتباط قوي وغير ممكن عكسه ولهذا لا يتم امتصاص المركب المتكون ويتم إخراجه في البراز.

2. التغذية غير المعوية الكاملة Total parenteral nutrition الخالية من إضافة البيوتين.

3. بعض الأدوية المضادة للتشنجات anticonvulsant drugs التي تثبط نقل البيوتين في الأغشية المخاطية المعوية وتسرع هدم البيوتين.

4. الاستعمال طويل المدى للمضادات الحيوية المؤثرة على البكتيريا المعوية.


الأعراض الأولى في نقص البيوتين متعلقة بالجلد والشعر مثل التهاب الجلد الدهني seborrheic dermatitis والالتهابات الفطرية وتساقط الشعر alopecia. وبعد أسبوع أو أسبوعين تبدأ الأعراض الأخرى ومنها تغير في الحالة العقلية واكتئاب بسيط والحساسية المفرطة hyperesthesias وتشوش الحس paresthesias ونعاس وآلام عضلية myalgia وتعب وهلوسة hallucination. وهناك أعراض خاصة بالجهاز الهضمي مثل الغثيان nausea وفقدان الشهية anorexia والقيء vomiting.

اقرأ أيضاً


  1. ^ Merck Index, 11th Edition, 1244.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
